C16H9NO6 — CID 168515933
4-(1,3-dioxoisoindol-2-yl)phthalic acid (PubChem CID 168515933) has the molecular formula C16H9NO6 and a molecular weight of 311.25 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)phthalic acid.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)phthalic acid |
|---|---|
| PubChem CID | 168515933 |
| Molecular Formula | C16H9NO6 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)phthalic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)c3ccccc3C2=O)cc1C(=O)O |
| InChI | InChI=1S/C16H9NO6/c18-13-9-3-1-2-4-10(9)14(19)17(13)8-5-6-11(15(20)21)12(7-8)16(22)23/h1-7H,(H,20,21)(H,22,23) |
| InChIKey | PIDUWBYPRGXIQI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|