C20H15N3O4 — CID 168517900
2-(3,5-dimethylpyrazol-1-yl)-5-(1,3-dioxoisoindol-2-yl)benzoic acid (PubChem CID 168517900) has the molecular formula C20H15N3O4 and a molecular weight of 361.36 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-5-(1,3-dioxoisoindol-2-yl)benzoic acid.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-5-(1,3-dioxoisoindol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 168517900 |
| Molecular Formula | C20H15N3O4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-5-(1,3-dioxoisoindol-2-yl)benzoic acid |
| SMILES | Cc1cc(C)n(-c2ccc(N3C(=O)c4ccccc4C3=O)cc2C(=O)O)n1 |
| InChI | InChI=1S/C20H15N3O4/c1-11-9-12(2)23(21-11)17-8-7-13(10-16(17)20(26)27)22-18(24)14-5-3-4-6-15(14)19(22)25/h3-10H,1-2H3,(H,26,27) |
| InChIKey | STLQOSZARMLNCP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|