5-(3,5-dimethylpyrazol-1-yl)-2-methoxybenzoic acid

C13H14N2O3 — CID 82513661

IUPAC5-(3,5-dimethylpyrazol-1-yl)-2-methoxybenzoic acid
SMILESCOc1ccc(-n2nc(C)cc2C)cc1C(=O)O
InChIInChI=1S/C13H14N2O3/c1-8-6-9(2)15(14-8)10-4-5-12(18-3)11(7-10)13(16)17/h4-7H,1-3H3,(H,16,17)
InChIKeyARVSZNCJZSFQQC-UHFFFAOYSA-N
MW246.27 g/mol
LogP2.20
Rot. Bonds3

About 5-(3,5-dimethylpyrazol-1-yl)-2-methoxybenzoic acid

5-(3,5-dimethylpyrazol-1-yl)-2-methoxybenzoic acid (PubChem CID 82513661) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 5-(3,5-dimethylpyrazol-1-yl)-2-methoxybenzoic acid.

Molecular Properties

Compound Name5-(3,5-dimethylpyrazol-1-yl)-2-methoxybenzoic acid
PubChem CID82513661
Molecular FormulaC13H14N2O3
Molecular Weight246.27 g/mol
Exact Mass246.10
IUPAC Name5-(3,5-dimethylpyrazol-1-yl)-2-methoxybenzoic acid
SMILESCOc1ccc(-n2nc(C)cc2C)cc1C(=O)O
InChIInChI=1S/C13H14N2O3/c1-8-6-9(2)15(14-8)10-4-5-12(18-3)11(7-10)13(16)17/h4-7H,1-3H3,(H,16,17)
InChIKeyARVSZNCJZSFQQC-UHFFFAOYSA-N
XLogP2.20
TPSA64.35 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.27
LogP ≤ 52.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(3,5-dimethylpyrazol-1-yl)-2-methoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(3,5-dimethylpyrazol-1-yl)-2-methoxybenzoic acid?
The IUPAC name of 5-(3,5-dimethylpyrazol-1-yl)-2-methoxybenzoic acid (CID 82513661) is 5-(3,5-dimethylpyrazol-1-yl)-2-methoxybenzoic acid.
What is the SMILES notation for 5-(3,5-dimethylpyrazol-1-yl)-2-methoxybenzoic acid?
The canonical SMILES for 5-(3,5-dimethylpyrazol-1-yl)-2-methoxybenzoic acid is COc1ccc(-n2nc(C)cc2C)cc1C(=O)O.
What is the InChIKey of 5-(3,5-dimethylpyrazol-1-yl)-2-methoxybenzoic acid?
The InChIKey is ARVSZNCJZSFQQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3/c1-8-6-9(2)15(14-8)10-4-5-12(18-3)11(7-10)13(16)17/h4-7H,1-3H3,(H,16,17).
What are the key properties of 5-(3,5-dimethylpyrazol-1-yl)-2-methoxybenzoic acid?
5-(3,5-dimethylpyrazol-1-yl)-2-methoxybenzoic acid has a molecular weight of 246.27 g/mol, XLogP of 2.20, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,5-dimethylpyrazol-1-yl)-2-methoxybenzoic acid is sourced from PubChem (CID 82513661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).