2-methoxy-5-(1,2,4-triazol-1-yl)benzoic acid

C10H9N3O3 — CID 82512716

IUPAC2-methoxy-5-(1,2,4-triazol-1-yl)benzoic acid
SMILESCOc1ccc(-n2cncn2)cc1C(=O)O
InChIInChI=1S/C10H9N3O3/c1-16-9-3-2-7(4-8(9)10(14)15)13-6-11-5-12-13/h2-6H,1H3,(H,14,15)
InChIKeyKPWKADXCAHFYTA-UHFFFAOYSA-N
MW219.20 g/mol
LogP0.97
Rot. Bonds3

About 2-methoxy-5-(1,2,4-triazol-1-yl)benzoic acid

2-methoxy-5-(1,2,4-triazol-1-yl)benzoic acid (PubChem CID 82512716) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is 2-methoxy-5-(1,2,4-triazol-1-yl)benzoic acid.

Molecular Properties

Compound Name2-methoxy-5-(1,2,4-triazol-1-yl)benzoic acid
PubChem CID82512716
Molecular FormulaC10H9N3O3
Molecular Weight219.20 g/mol
Exact Mass219.06
IUPAC Name2-methoxy-5-(1,2,4-triazol-1-yl)benzoic acid
SMILESCOc1ccc(-n2cncn2)cc1C(=O)O
InChIInChI=1S/C10H9N3O3/c1-16-9-3-2-7(4-8(9)10(14)15)13-6-11-5-12-13/h2-6H,1H3,(H,14,15)
InChIKeyKPWKADXCAHFYTA-UHFFFAOYSA-N
XLogP0.97
TPSA77.24 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.20
LogP ≤ 50.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-methoxy-5-(1,2,4-triazol-1-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methoxy-5-(1,2,4-triazol-1-yl)benzoic acid?
The IUPAC name of 2-methoxy-5-(1,2,4-triazol-1-yl)benzoic acid (CID 82512716) is 2-methoxy-5-(1,2,4-triazol-1-yl)benzoic acid.
What is the SMILES notation for 2-methoxy-5-(1,2,4-triazol-1-yl)benzoic acid?
The canonical SMILES for 2-methoxy-5-(1,2,4-triazol-1-yl)benzoic acid is COc1ccc(-n2cncn2)cc1C(=O)O.
What is the InChIKey of 2-methoxy-5-(1,2,4-triazol-1-yl)benzoic acid?
The InChIKey is KPWKADXCAHFYTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O3/c1-16-9-3-2-7(4-8(9)10(14)15)13-6-11-5-12-13/h2-6H,1H3,(H,14,15).
What are the key properties of 2-methoxy-5-(1,2,4-triazol-1-yl)benzoic acid?
2-methoxy-5-(1,2,4-triazol-1-yl)benzoic acid has a molecular weight of 219.20 g/mol, XLogP of 0.97, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-(1,2,4-triazol-1-yl)benzoic acid is sourced from PubChem (CID 82512716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).