C18H18N6O5S — CID 51134168
2-methoxy-N-[2-oxo-2-[4-(1,2,4-triazol-1-yl)anilino]ethyl]-5-sulfamoylbenzamide (PubChem CID 51134168) has the molecular formula C18H18N6O5S and a molecular weight of 430.45 g/mol. Its IUPAC name is 2-methoxy-N-[2-oxo-2-[4-(1,2,4-triazol-1-yl)anilino]ethyl]-5-sulfamoylbenzamide.
| Compound Name | 2-methoxy-N-[2-oxo-2-[4-(1,2,4-triazol-1-yl)anilino]ethyl]-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 51134168 |
| Molecular Formula | C18H18N6O5S |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 2-methoxy-N-[2-oxo-2-[4-(1,2,4-triazol-1-yl)anilino]ethyl]-5-sulfamoylbenzamide |
| SMILES | COc1ccc(S(N)(=O)=O)cc1C(=O)NCC(=O)Nc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C18H18N6O5S/c1-29-16-7-6-14(30(19,27)28)8-15(16)18(26)21-9-17(25)23-12-2-4-13(5-3-12)24-11-20-10-22-24/h2-8,10-11H,9H2,1H3,(H,21,26)(H,23,25)(H2,19,27,28) |
| InChIKey | DYDJQGQLODNVFD-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |