C16H12ClIN4O2 — CID 55608636
5-chloro-4-iodo-2-methoxy-N-[4-(1,2,4-triazol-1-yl)phenyl]benzamide (PubChem CID 55608636) has the molecular formula C16H12ClIN4O2 and a molecular weight of 454.66 g/mol. Its IUPAC name is 5-chloro-4-iodo-2-methoxy-N-[4-(1,2,4-triazol-1-yl)phenyl]benzamide.
| Compound Name | 5-chloro-4-iodo-2-methoxy-N-[4-(1,2,4-triazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 55608636 |
| Molecular Formula | C16H12ClIN4O2 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 453.97 |
| IUPAC Name | 5-chloro-4-iodo-2-methoxy-N-[4-(1,2,4-triazol-1-yl)phenyl]benzamide |
| SMILES | COc1cc(I)c(Cl)cc1C(=O)Nc1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C16H12ClIN4O2/c1-24-15-7-14(18)13(17)6-12(15)16(23)21-10-2-4-11(5-3-10)22-9-19-8-20-22/h2-9H,1H3,(H,21,23) |
| InChIKey | BOYSCLODFWGNQA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|