C20H16ClIN2O3 — CID 55881478
5-chloro-4-iodo-2-methoxy-N-[4-[(2-oxo-1-pyridinyl)methyl]phenyl]benzamide (PubChem CID 55881478) has the molecular formula C20H16ClIN2O3 and a molecular weight of 494.72 g/mol. Its IUPAC name is 5-chloro-4-iodo-2-methoxy-N-[4-[(2-oxo-1-pyridinyl)methyl]phenyl]benzamide.
| Compound Name | 5-chloro-4-iodo-2-methoxy-N-[4-[(2-oxo-1-pyridinyl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 55881478 |
| Molecular Formula | C20H16ClIN2O3 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 493.99 |
| IUPAC Name | 5-chloro-4-iodo-2-methoxy-N-[4-[(2-oxo-1-pyridinyl)methyl]phenyl]benzamide |
| SMILES | COc1cc(I)c(Cl)cc1C(=O)Nc1ccc(Cn2ccccc2=O)cc1 |
| InChI | InChI=1S/C20H16ClIN2O3/c1-27-18-11-17(22)16(21)10-15(18)20(26)23-14-7-5-13(6-8-14)12-24-9-3-2-4-19(24)25/h2-11H,12H2,1H3,(H,23,26) |
| InChIKey | KYJDWIFDQLQPTR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|