C21H21N3O5S — CID 55855260
4-methoxy-3-(methylsulfamoyl)-N-[4-[(2-oxo-1-pyridinyl)methyl]phenyl]benzamide (PubChem CID 55855260) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is 4-methoxy-3-(methylsulfamoyl)-N-[4-[(2-oxo-1-pyridinyl)methyl]phenyl]benzamide.
| Compound Name | 4-methoxy-3-(methylsulfamoyl)-N-[4-[(2-oxo-1-pyridinyl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 55855260 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 4-methoxy-3-(methylsulfamoyl)-N-[4-[(2-oxo-1-pyridinyl)methyl]phenyl]benzamide |
| SMILES | CNS(=O)(=O)c1cc(C(=O)Nc2ccc(Cn3ccccc3=O)cc2)ccc1OC |
| InChI | InChI=1S/C21H21N3O5S/c1-22-30(27,28)19-13-16(8-11-18(19)29-2)21(26)23-17-9-6-15(7-10-17)14-24-12-4-3-5-20(24)25/h3-13,22H,14H2,1-2H3,(H,23,26) |
| InChIKey | HNBDCLKZVRCCEL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |