C21H20FN3O4S — CID 55881988
3-(dimethylsulfamoyl)-4-fluoro-N-[4-[(2-oxo-1-pyridinyl)methyl]phenyl]benzamide (PubChem CID 55881988) has the molecular formula C21H20FN3O4S and a molecular weight of 429.47 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-4-fluoro-N-[4-[(2-oxo-1-pyridinyl)methyl]phenyl]benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-4-fluoro-N-[4-[(2-oxo-1-pyridinyl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 55881988 |
| Molecular Formula | C21H20FN3O4S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 3-(dimethylsulfamoyl)-4-fluoro-N-[4-[(2-oxo-1-pyridinyl)methyl]phenyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1cc(C(=O)Nc2ccc(Cn3ccccc3=O)cc2)ccc1F |
| InChI | InChI=1S/C21H20FN3O4S/c1-24(2)30(28,29)19-13-16(8-11-18(19)22)21(27)23-17-9-6-15(7-10-17)14-25-12-4-3-5-20(25)26/h3-13H,14H2,1-2H3,(H,23,27) |
| InChIKey | JMOHNHQGAPOCJF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |