C14H10ClN5O — CID 30765929
2-chloro-N-[4-(1,2,4-triazol-1-yl)phenyl]pyridine-4-carboxamide (PubChem CID 30765929) has the molecular formula C14H10ClN5O and a molecular weight of 299.72 g/mol. Its IUPAC name is 2-chloro-N-[4-(1,2,4-triazol-1-yl)phenyl]pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[4-(1,2,4-triazol-1-yl)phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 30765929 |
| Molecular Formula | C14H10ClN5O |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 2-chloro-N-[4-(1,2,4-triazol-1-yl)phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(-n2cncn2)cc1)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C14H10ClN5O/c15-13-7-10(5-6-17-13)14(21)19-11-1-3-12(4-2-11)20-9-16-8-18-20/h1-9H,(H,19,21) |
| InChIKey | YULMUMXRTQZHAS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|