C16H12N4O3 — CID 22108068
N-(1,3-benzodioxol-5-yl)-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 22108068) has the molecular formula C16H12N4O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 22108068 |
| Molecular Formula | C16H12N4O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C16H12N4O3/c21-16(19-12-3-6-14-15(7-12)23-10-22-14)11-1-4-13(5-2-11)20-9-17-8-18-20/h1-9H,10H2,(H,19,21) |
| InChIKey | MEZLFMDYNJGOET-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |