C17H16N4O3S — CID 37121988
4-(methylsulfonylmethyl)-N-[4-(1,2,4-triazol-1-yl)phenyl]benzamide (PubChem CID 37121988) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is 4-(methylsulfonylmethyl)-N-[4-(1,2,4-triazol-1-yl)phenyl]benzamide.
| Compound Name | 4-(methylsulfonylmethyl)-N-[4-(1,2,4-triazol-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 37121988 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 4-(methylsulfonylmethyl)-N-[4-(1,2,4-triazol-1-yl)phenyl]benzamide |
| SMILES | CS(=O)(=O)Cc1ccc(C(=O)Nc2ccc(-n3cncn3)cc2)cc1 |
| InChI | InChI=1S/C17H16N4O3S/c1-25(23,24)10-13-2-4-14(5-3-13)17(22)20-15-6-8-16(9-7-15)21-12-18-11-19-21/h2-9,11-12H,10H2,1H3,(H,20,22) |
| InChIKey | IEWMGFWVHKJTMZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |