C17H16N4O3 — CID 18104017
N-(2,4-dimethoxyphenyl)-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 18104017) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 18104017 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccc(-n3cncn3)cc2)c(OC)c1 |
| InChI | InChI=1S/C17H16N4O3/c1-23-14-7-8-15(16(9-14)24-2)20-17(22)12-3-5-13(6-4-12)21-11-18-10-19-21/h3-11H,1-2H3,(H,20,22) |
| InChIKey | HUENASGAMYCGHS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |