C15H10BrFN4O — CID 78803403
N-(4-bromo-2-fluorophenyl)-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 78803403) has the molecular formula C15H10BrFN4O and a molecular weight of 361.17 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 78803403 |
| Molecular Formula | C15H10BrFN4O |
| Molecular Weight | 361.17 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | O=C(Nc1ccc(Br)cc1F)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C15H10BrFN4O/c16-11-3-6-14(13(17)7-11)20-15(22)10-1-4-12(5-2-10)21-9-18-8-19-21/h1-9H,(H,20,22) |
| InChIKey | LUJPOOOIHGLMBQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.17 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |