C18H18N4O — CID 51192150
N-(2-propan-2-ylphenyl)-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 51192150) has the molecular formula C18H18N4O and a molecular weight of 306.37 g/mol. Its IUPAC name is N-(2-propan-2-ylphenyl)-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-(2-propan-2-ylphenyl)-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 51192150 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-(2-propan-2-ylphenyl)-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CC(C)c1ccccc1NC(=O)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C18H18N4O/c1-13(2)16-5-3-4-6-17(16)21-18(23)14-7-9-15(10-8-14)22-12-19-11-20-22/h3-13H,1-2H3,(H,21,23) |
| InChIKey | MBGYSBUWJXSBAL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |