C21H25N5O — CID 18167141
N-[2-(diethylamino)-2-phenylethyl]-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 18167141) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-phenylethyl]-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[2-(diethylamino)-2-phenylethyl]-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 18167141 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | N-[2-(diethylamino)-2-phenylethyl]-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CCN(CC)C(CNC(=O)c1ccc(-n2cncn2)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H25N5O/c1-3-25(4-2)20(17-8-6-5-7-9-17)14-23-21(27)18-10-12-19(13-11-18)26-16-22-15-24-26/h5-13,15-16,20H,3-4,14H2,1-2H3,(H,23,27) |
| InChIKey | UUMTYQMTSPFHKY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |