C18H23N3O — CID 42917068
N-[2-(diethylamino)-2-phenylethyl]pyridine-2-carboxamide (PubChem CID 42917068) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is N-[2-(diethylamino)-2-phenylethyl]pyridine-2-carboxamide.
| Compound Name | N-[2-(diethylamino)-2-phenylethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 42917068 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N-[2-(diethylamino)-2-phenylethyl]pyridine-2-carboxamide |
| SMILES | CCN(CC)C(CNC(=O)c1ccccn1)c1ccccc1 |
| InChI | InChI=1S/C18H23N3O/c1-3-21(4-2)17(15-10-6-5-7-11-15)14-20-18(22)16-12-8-9-13-19-16/h5-13,17H,3-4,14H2,1-2H3,(H,20,22) |
| InChIKey | XYWNTULSNWHVCC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |