C21H22N4O3 — CID 51256987
propan-2-yl 3-phenyl-3-[[4-(1,2,4-triazol-1-yl)benzoyl]amino]propanoate (PubChem CID 51256987) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is propan-2-yl 3-phenyl-3-[[4-(1,2,4-triazol-1-yl)benzoyl]amino]propanoate.
| Compound Name | propan-2-yl 3-phenyl-3-[[4-(1,2,4-triazol-1-yl)benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 51256987 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | propan-2-yl 3-phenyl-3-[[4-(1,2,4-triazol-1-yl)benzoyl]amino]propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)c1ccc(-n2cncn2)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H22N4O3/c1-15(2)28-20(26)12-19(16-6-4-3-5-7-16)24-21(27)17-8-10-18(11-9-17)25-14-22-13-23-25/h3-11,13-15,19H,12H2,1-2H3,(H,24,27) |
| InChIKey | WISVSEPRURRMJZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |