C23H28N2O4 — CID 46686826
propan-2-yl 3-[[4-(2-methylpropanoylamino)benzoyl]amino]-3-phenylpropanoate (PubChem CID 46686826) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is propan-2-yl 3-[[4-(2-methylpropanoylamino)benzoyl]amino]-3-phenylpropanoate.
| Compound Name | propan-2-yl 3-[[4-(2-methylpropanoylamino)benzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 46686826 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | propan-2-yl 3-[[4-(2-methylpropanoylamino)benzoyl]amino]-3-phenylpropanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)c1ccc(NC(=O)C(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O4/c1-15(2)22(27)24-19-12-10-18(11-13-19)23(28)25-20(14-21(26)29-16(3)4)17-8-6-5-7-9-17/h5-13,15-16,20H,14H2,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | UBZRMJZQXWXDFX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |