C17H15ClN4O2 — CID 110004658
N-[1-(4-chlorophenyl)-2-hydroxyethyl]-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 110004658) has the molecular formula C17H15ClN4O2 and a molecular weight of 342.79 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2-hydroxyethyl]-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-[1-(4-chlorophenyl)-2-hydroxyethyl]-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 110004658 |
| Molecular Formula | C17H15ClN4O2 |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2-hydroxyethyl]-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | O=C(NC(CO)c1ccc(Cl)cc1)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C17H15ClN4O2/c18-14-5-1-12(2-6-14)16(9-23)21-17(24)13-3-7-15(8-4-13)22-11-19-10-20-22/h1-8,10-11,16,23H,9H2,(H,21,24) |
| InChIKey | UZGSQWNAGGAJGQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |