C16H8N2O4 — CID 168518996
2-cyano-4-(1,3-dioxoisoindol-2-yl)benzoic acid (PubChem CID 168518996) has the molecular formula C16H8N2O4 and a molecular weight of 292.25 g/mol. Its IUPAC name is 2-cyano-4-(1,3-dioxoisoindol-2-yl)benzoic acid.
| Compound Name | 2-cyano-4-(1,3-dioxoisoindol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 168518996 |
| Molecular Formula | C16H8N2O4 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-cyano-4-(1,3-dioxoisoindol-2-yl)benzoic acid |
| SMILES | N#Cc1cc(N2C(=O)c3ccccc3C2=O)ccc1C(=O)O |
| InChI | InChI=1S/C16H8N2O4/c17-8-9-7-10(5-6-11(9)16(21)22)18-14(19)12-3-1-2-4-13(12)15(18)20/h1-7H,(H,21,22) |
| InChIKey | JQGCPMDIAHNXQX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|