C15H8N2O3 — CID 168517158
3-(1,3-dioxoisoindol-2-yl)-5-hydroxybenzonitrile (PubChem CID 168517158) has the molecular formula C15H8N2O3 and a molecular weight of 264.24 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-5-hydroxybenzonitrile.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-5-hydroxybenzonitrile |
|---|---|
| PubChem CID | 168517158 |
| Molecular Formula | C15H8N2O3 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-5-hydroxybenzonitrile |
| SMILES | N#Cc1cc(O)cc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C15H8N2O3/c16-8-9-5-10(7-11(18)6-9)17-14(19)12-3-1-2-4-13(12)15(17)20/h1-7,18H |
| InChIKey | ZWFIBXBCQUJMFF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|