C17H11NO3 — CID 60815166
2-[3-(3-hydroxyprop-1-ynyl)phenyl]isoindole-1,3-dione (PubChem CID 60815166) has the molecular formula C17H11NO3 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-[3-(3-hydroxyprop-1-ynyl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(3-hydroxyprop-1-ynyl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 60815166 |
| Molecular Formula | C17H11NO3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-[3-(3-hydroxyprop-1-ynyl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cccc(C#CCO)c1 |
| InChI | InChI=1S/C17H11NO3/c19-10-4-6-12-5-3-7-13(11-12)18-16(20)14-8-1-2-9-15(14)17(18)21/h1-3,5,7-9,11,19H,10H2 |
| InChIKey | PXHRHDYYQKGKQJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|