C20H11NO6 — CID 1102906
2-(4-carboxyphenyl)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid (PubChem CID 1102906) has the molecular formula C20H11NO6 and a molecular weight of 361.31 g/mol. Its IUPAC name is 2-(4-carboxyphenyl)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid.
| Compound Name | 2-(4-carboxyphenyl)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 1102906 |
| Molecular Formula | C20H11NO6 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 2-(4-carboxyphenyl)-1,3-dioxobenzo[de]isoquinoline-6-carboxylic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)c3cccc4c(C(=O)O)ccc(c34)C2=O)cc1 |
| InChI | InChI=1S/C20H11NO6/c22-17-14-3-1-2-12-13(20(26)27)8-9-15(16(12)14)18(23)21(17)11-6-4-10(5-7-11)19(24)25/h1-9H,(H,24,25)(H,26,27) |
| InChIKey | OGCKXYFATMHUQP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|