C50H26F2N2O7 — CID 100938303
6-(4-fluorobenzoyl)-2-[4-[4-[6-(4-fluorobenzoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl]phenoxy]phenyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 100938303) has the molecular formula C50H26F2N2O7 and a molecular weight of 804.76 g/mol. Its IUPAC name is 6-(4-fluorobenzoyl)-2-[4-[4-[6-(4-fluorobenzoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl]phenoxy]phenyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-(4-fluorobenzoyl)-2-[4-[4-[6-(4-fluorobenzoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl]phenoxy]phenyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 100938303 |
| Molecular Formula | C50H26F2N2O7 |
| Molecular Weight | 804.76 g/mol |
| Exact Mass | 804.17 |
| IUPAC Name | 6-(4-fluorobenzoyl)-2-[4-[4-[6-(4-fluorobenzoyl)-1,3-dioxobenzo[de]isoquinolin-2-yl]phenoxy]phenyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C(c1ccc(F)cc1)c1ccc2c3c(cccc13)C(=O)N(c1ccc(Oc3ccc(N4C(=O)c5cccc6c(C(=O)c7ccc(F)cc7)ccc(c56)C4=O)cc3)cc1)C2=O |
| InChI | InChI=1S/C50H26F2N2O7/c51-29-11-7-27(8-12-29)45(55)37-23-25-41-43-35(37)3-1-5-39(43)47(57)53(49(41)59)31-15-19-33(20-16-31)61-34-21-17-32(18-22-34)54-48(58)40-6-2-4-36-38(24-26-42(44(36)40)50(54)60)46(56)28-9-13-30(52)14-10-28/h1-26H |
| InChIKey | KIXSJDOSUKMQGK-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.76 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|