C22H17NO3 — CID 540575
6-acetyl-2-(3,4-dimethylphenyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 540575) has the molecular formula C22H17NO3 and a molecular weight of 343.38 g/mol. Its IUPAC name is 6-acetyl-2-(3,4-dimethylphenyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-acetyl-2-(3,4-dimethylphenyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 540575 |
| Molecular Formula | C22H17NO3 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 6-acetyl-2-(3,4-dimethylphenyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | CC(=O)c1ccc2c3c(cccc13)C(=O)N(c1ccc(C)c(C)c1)C2=O |
| InChI | InChI=1S/C22H17NO3/c1-12-7-8-15(11-13(12)2)23-21(25)18-6-4-5-17-16(14(3)24)9-10-19(20(17)18)22(23)26/h4-11H,1-3H3 |
| InChIKey | JHPNRPSWGLXONC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|