C20H14BrNO2 — CID 102053151
6-bromo-2-(3,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 102053151) has the molecular formula C20H14BrNO2 and a molecular weight of 380.24 g/mol. Its IUPAC name is 6-bromo-2-(3,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-bromo-2-(3,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 102053151 |
| Molecular Formula | C20H14BrNO2 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | 6-bromo-2-(3,5-dimethylphenyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | Cc1cc(C)cc(N2C(=O)c3cccc4c(Br)ccc(c34)C2=O)c1 |
| InChI | InChI=1S/C20H14BrNO2/c1-11-8-12(2)10-13(9-11)22-19(23)15-5-3-4-14-17(21)7-6-16(18(14)15)20(22)24/h3-10H,1-2H3 |
| InChIKey | TXXGDEGGSOXHLL-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|