C23H18BrNO4 — CID 156857041
methyl 4-[4-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl]butanoate (PubChem CID 156857041) has the molecular formula C23H18BrNO4 and a molecular weight of 452.30 g/mol. Its IUPAC name is methyl 4-[4-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl]butanoate.
| Compound Name | methyl 4-[4-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl]butanoate |
|---|---|
| PubChem CID | 156857041 |
| Molecular Formula | C23H18BrNO4 |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | methyl 4-[4-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)phenyl]butanoate |
| SMILES | COC(=O)CCCc1ccc(N2C(=O)c3cccc4c(Br)ccc(c34)C2=O)cc1 |
| InChI | InChI=1S/C23H18BrNO4/c1-29-20(26)7-2-4-14-8-10-15(11-9-14)25-22(27)17-6-3-5-16-19(24)13-12-18(21(16)17)23(25)28/h3,5-6,8-13H,2,4,7H2,1H3 |
| InChIKey | FHQCOBNJWGYMMH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|