C46H32F2N2O4 — CID 165369593
(3,5-difluorophenyl) 4-[4-[1,3-dioxo-6-[4-(N-phenylanilino)phenyl]benzo[de]isoquinolin-2-yl]phenyl]butanoate (PubChem CID 165369593) has the molecular formula C46H32F2N2O4 and a molecular weight of 714.77 g/mol. Its IUPAC name is (3,5-difluorophenyl) 4-[4-[1,3-dioxo-6-[4-(N-phenylanilino)phenyl]benzo[de]isoquinolin-2-yl]phenyl]butanoate.
| Compound Name | (3,5-difluorophenyl) 4-[4-[1,3-dioxo-6-[4-(N-phenylanilino)phenyl]benzo[de]isoquinolin-2-yl]phenyl]butanoate |
|---|---|
| PubChem CID | 165369593 |
| Molecular Formula | C46H32F2N2O4 |
| Molecular Weight | 714.77 g/mol |
| Exact Mass | 714.23 |
| IUPAC Name | (3,5-difluorophenyl) 4-[4-[1,3-dioxo-6-[4-(N-phenylanilino)phenyl]benzo[de]isoquinolin-2-yl]phenyl]butanoate |
| SMILES | O=C(CCCc1ccc(N2C(=O)c3cccc4c(-c5ccc(N(c6ccccc6)c6ccccc6)cc5)ccc(c34)C2=O)cc1)Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C46H32F2N2O4/c47-32-27-33(48)29-38(28-32)54-43(51)16-7-9-30-17-21-37(22-18-30)50-45(52)41-15-8-14-40-39(25-26-42(44(40)41)46(50)53)31-19-23-36(24-20-31)49(34-10-3-1-4-11-34)35-12-5-2-6-13-35/h1-6,8,10-15,17-29H,7,9,16H2 |
| InChIKey | NJVGMABHRUSDHW-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.77 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|