C39H25N3O2S — CID 177498733
6-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-2-pyridin-2-ylbenzo[de]isoquinoline-1,3-dione (PubChem CID 177498733) has the molecular formula C39H25N3O2S and a molecular weight of 599.72 g/mol. Its IUPAC name is 6-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-2-pyridin-2-ylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-2-pyridin-2-ylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 177498733 |
| Molecular Formula | C39H25N3O2S |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.17 |
| IUPAC Name | 6-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-2-pyridin-2-ylbenzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3c(-c4ccc(-c5ccc(N(c6ccccc6)c6ccccc6)cc5)s4)ccc(c23)C(=O)N1c1ccccn1 |
| InChI | InChI=1S/C39H25N3O2S/c43-38-32-15-9-14-31-30(21-22-33(37(31)32)39(44)42(38)36-16-7-8-25-40-36)35-24-23-34(45-35)26-17-19-29(20-18-26)41(27-10-3-1-4-11-27)28-12-5-2-6-13-28/h1-25H |
| InChIKey | NKKFUKFDJYMGIN-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|