C28H17NO2S — CID 177498171
2-phenyl-6-(5-phenylthiophen-2-yl)benzo[de]isoquinoline-1,3-dione (PubChem CID 177498171) has the molecular formula C28H17NO2S and a molecular weight of 431.52 g/mol. Its IUPAC name is 2-phenyl-6-(5-phenylthiophen-2-yl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-phenyl-6-(5-phenylthiophen-2-yl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 177498171 |
| Molecular Formula | C28H17NO2S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 2-phenyl-6-(5-phenylthiophen-2-yl)benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3c(-c4ccc(-c5ccccc5)s4)ccc(c23)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C28H17NO2S/c30-27-22-13-7-12-21-20(25-17-16-24(32-25)18-8-3-1-4-9-18)14-15-23(26(21)22)28(31)29(27)19-10-5-2-6-11-19/h1-17H |
| InChIKey | IRUVFKJTSOKUCO-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|