C51H33NO2 — CID 123589149
6-(7-hepta-2,4,6-trien-3-yl-12-phenylbenzo[k]fluoranthen-3-yl)-2-phenylbenzo[de]isoquinoline-1,3-dione (PubChem CID 123589149) has the molecular formula C51H33NO2 and a molecular weight of 691.83 g/mol. Its IUPAC name is 6-(7-hepta-2,4,6-trien-3-yl-12-phenylbenzo[k]fluoranthen-3-yl)-2-phenylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-(7-hepta-2,4,6-trien-3-yl-12-phenylbenzo[k]fluoranthen-3-yl)-2-phenylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 123589149 |
| Molecular Formula | C51H33NO2 |
| Molecular Weight | 691.83 g/mol |
| Exact Mass | 691.25 |
| IUPAC Name | 6-(7-hepta-2,4,6-trien-3-yl-12-phenylbenzo[k]fluoranthen-3-yl)-2-phenylbenzo[de]isoquinoline-1,3-dione |
| SMILES | C=CC=CC(=CC)c1c2c(c(-c3ccccc3)c3ccccc13)-c1ccc(-c3ccc4c5c(cccc35)C(=O)N(c3ccccc3)C4=O)c3cccc-2c13 |
| InChI | InChI=1S/C51H33NO2/c1-3-5-16-31(4-2)44-38-21-12-13-22-39(38)45(32-17-8-6-9-18-32)49-41-29-27-34(36-23-14-25-40(46(36)41)48(44)49)35-28-30-43-47-37(35)24-15-26-42(47)50(53)52(51(43)54)33-19-10-7-11-20-33/h3-30H,1H2,2H3 |
| InChIKey | CKLYRFULADEJIV-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.83 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|