C30H19NO3 — CID 163982470
6-(3-hydroxy-2-phenylphenyl)-2-phenylbenzo[de]isoquinoline-1,3-dione (PubChem CID 163982470) has the molecular formula C30H19NO3 and a molecular weight of 441.49 g/mol. Its IUPAC name is 6-(3-hydroxy-2-phenylphenyl)-2-phenylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-(3-hydroxy-2-phenylphenyl)-2-phenylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 163982470 |
| Molecular Formula | C30H19NO3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 6-(3-hydroxy-2-phenylphenyl)-2-phenylbenzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3c(-c4cccc(O)c4-c4ccccc4)ccc(c23)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C30H19NO3/c32-26-16-8-14-22(27(26)19-9-3-1-4-10-19)21-17-18-25-28-23(21)13-7-15-24(28)29(33)31(30(25)34)20-11-5-2-6-12-20/h1-18,32H |
| InChIKey | SZPZTMQKCNSISR-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|