C20H17N3O2 — CID 11566147
6-(2-aminoethylamino)-2-phenylbenzo[de]isoquinoline-1,3-dione (PubChem CID 11566147) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 6-(2-aminoethylamino)-2-phenylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-(2-aminoethylamino)-2-phenylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 11566147 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 6-(2-aminoethylamino)-2-phenylbenzo[de]isoquinoline-1,3-dione |
| SMILES | NCCNc1ccc2c3c(cccc13)C(=O)N(c1ccccc1)C2=O |
| InChI | InChI=1S/C20H17N3O2/c21-11-12-22-17-10-9-16-18-14(17)7-4-8-15(18)19(24)23(20(16)25)13-5-2-1-3-6-13/h1-10,22H,11-12,21H2 |
| InChIKey | PBFVSVNKSRHMPI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|