C28H22BrN3O4 — CID 11706582
benzyl N-[2-[[2-(3-bromophenyl)-1,3-dioxobenzo[de]isoquinolin-6-yl]amino]ethyl]carbamate (PubChem CID 11706582) has the molecular formula C28H22BrN3O4 and a molecular weight of 544.41 g/mol. Its IUPAC name is benzyl N-[2-[[2-(3-bromophenyl)-1,3-dioxobenzo[de]isoquinolin-6-yl]amino]ethyl]carbamate.
| Compound Name | benzyl N-[2-[[2-(3-bromophenyl)-1,3-dioxobenzo[de]isoquinolin-6-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 11706582 |
| Molecular Formula | C28H22BrN3O4 |
| Molecular Weight | 544.41 g/mol |
| Exact Mass | 543.08 |
| IUPAC Name | benzyl N-[2-[[2-(3-bromophenyl)-1,3-dioxobenzo[de]isoquinolin-6-yl]amino]ethyl]carbamate |
| SMILES | O=C(NCCNc1ccc2c3c(cccc13)C(=O)N(c1cccc(Br)c1)C2=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H22BrN3O4/c29-19-8-4-9-20(16-19)32-26(33)22-11-5-10-21-24(13-12-23(25(21)22)27(32)34)30-14-15-31-28(35)36-17-18-6-2-1-3-7-18/h1-13,16,30H,14-15,17H2,(H,31,35) |
| InChIKey | MOVZGJNDODMZGO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.41 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|