C20H20N4O4 — CID 172636201
2-[2-[(1,3-dioxo-2-prop-2-ynylbenzo[de]isoquinolin-6-yl)amino]ethylamino]ethylcarbamic acid (PubChem CID 172636201) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 2-[2-[(1,3-dioxo-2-prop-2-ynylbenzo[de]isoquinolin-6-yl)amino]ethylamino]ethylcarbamic acid.
| Compound Name | 2-[2-[(1,3-dioxo-2-prop-2-ynylbenzo[de]isoquinolin-6-yl)amino]ethylamino]ethylcarbamic acid |
|---|---|
| PubChem CID | 172636201 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 2-[2-[(1,3-dioxo-2-prop-2-ynylbenzo[de]isoquinolin-6-yl)amino]ethylamino]ethylcarbamic acid |
| SMILES | C#CCN1C(=O)c2cccc3c(NCCNCCNC(=O)O)ccc(c23)C1=O |
| InChI | InChI=1S/C20H20N4O4/c1-2-12-24-18(25)14-5-3-4-13-16(7-6-15(17(13)14)19(24)26)22-10-8-21-9-11-23-20(27)28/h1,3-7,21-23H,8-12H2,(H,27,28) |
| InChIKey | WHERMVKGXZUPII-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|