C20H16BrN3O2 — CID 11603937
6-(2-aminoethylamino)-2-(3-bromophenyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 11603937) has the molecular formula C20H16BrN3O2 and a molecular weight of 410.27 g/mol. Its IUPAC name is 6-(2-aminoethylamino)-2-(3-bromophenyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-(2-aminoethylamino)-2-(3-bromophenyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 11603937 |
| Molecular Formula | C20H16BrN3O2 |
| Molecular Weight | 410.27 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 6-(2-aminoethylamino)-2-(3-bromophenyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | NCCNc1ccc2c3c(cccc13)C(=O)N(c1cccc(Br)c1)C2=O |
| InChI | InChI=1S/C20H16BrN3O2/c21-12-3-1-4-13(11-12)24-19(25)15-6-2-5-14-17(23-10-9-22)8-7-16(18(14)15)20(24)26/h1-8,11,23H,9-10,22H2 |
| InChIKey | VJUSPNPVKIXONP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|