C22H21N3O4S — CID 71741249
4-[6-(butylamino)-1,3-dioxobenzo[de]isoquinolin-2-yl]benzenesulfonamide (PubChem CID 71741249) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is 4-[6-(butylamino)-1,3-dioxobenzo[de]isoquinolin-2-yl]benzenesulfonamide.
| Compound Name | 4-[6-(butylamino)-1,3-dioxobenzo[de]isoquinolin-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 71741249 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 4-[6-(butylamino)-1,3-dioxobenzo[de]isoquinolin-2-yl]benzenesulfonamide |
| SMILES | CCCCNc1ccc2c3c(cccc13)C(=O)N(c1ccc(S(N)(=O)=O)cc1)C2=O |
| InChI | InChI=1S/C22H21N3O4S/c1-2-3-13-24-19-12-11-18-20-16(19)5-4-6-17(20)21(26)25(22(18)27)14-7-9-15(10-8-14)30(23,28)29/h4-12,24H,2-3,13H2,1H3,(H2,23,28,29) |
| InChIKey | CURXQDRWIYYARW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|