C36H24Br2N4O9S2 — CID 160500921
4-aminobenzenesulfonamide;4-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)benzenesulfonamide;8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (PubChem CID 160500921) has the molecular formula C36H24Br2N4O9S2 and a molecular weight of 880.55 g/mol. Its IUPAC name is 4-aminobenzenesulfonamide;4-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)benzenesulfonamide;8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione.
| Compound Name | 4-aminobenzenesulfonamide;4-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)benzenesulfonamide;8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 160500921 |
| Molecular Formula | C36H24Br2N4O9S2 |
| Molecular Weight | 880.55 g/mol |
| Exact Mass | 877.94 |
| IUPAC Name | 4-aminobenzenesulfonamide;4-(6-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)benzenesulfonamide;8-bromo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)c3cccc4c(Br)ccc(c34)C2=O)cc1.Nc1ccc(S(N)(=O)=O)cc1.O=C1OC(=O)c2ccc(Br)c3cccc1c23 |
| InChI | InChI=1S/C18H11BrN2O4S.C12H5BrO3.C6H8N2O2S/c19-15-9-8-14-16-12(15)2-1-3-13(16)17(22)21(18(14)23)10-4-6-11(7-5-10)26(20,24)25;13-9-5-4-8-10-6(9)2-1-3-7(10)11(14)16-12(8)15;7-5-1-3-6(4-2-5)11(8,9)10/h1-9H,(H2,20,24,25);1-5H;1-4H,7H2,(H2,8,9,10) |
| InChIKey | QRTQDEISOKHEMG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 227.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|