C30H17BrN2O2S2 — CID 102499868
6-bromo-2-[4-(2,5-dithiophen-2-ylpyrrol-1-yl)phenyl]benzo[de]isoquinoline-1,3-dione (PubChem CID 102499868) has the molecular formula C30H17BrN2O2S2 and a molecular weight of 581.52 g/mol. Its IUPAC name is 6-bromo-2-[4-(2,5-dithiophen-2-ylpyrrol-1-yl)phenyl]benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-bromo-2-[4-(2,5-dithiophen-2-ylpyrrol-1-yl)phenyl]benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 102499868 |
| Molecular Formula | C30H17BrN2O2S2 |
| Molecular Weight | 581.52 g/mol |
| Exact Mass | 579.99 |
| IUPAC Name | 6-bromo-2-[4-(2,5-dithiophen-2-ylpyrrol-1-yl)phenyl]benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3c(Br)ccc(c23)C(=O)N1c1ccc(-n2c(-c3cccs3)ccc2-c2cccs2)cc1 |
| InChI | InChI=1S/C30H17BrN2O2S2/c31-23-13-12-22-28-20(23)4-1-5-21(28)29(34)33(30(22)35)19-10-8-18(9-11-19)32-24(26-6-2-16-36-26)14-15-25(32)27-7-3-17-37-27/h1-17H |
| InChIKey | VIHRPABYLUQXFS-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.52 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|