C24H14BrINO2 — CID 132519977
CID 132519977 (PubChem CID 132519977) has the molecular formula C24H14BrINO2 and a molecular weight of 555.19 g/mol.
| Compound Name | CID 132519977 |
|---|---|
| PubChem CID | 132519977 |
| Molecular Formula | C24H14BrINO2 |
| Molecular Weight | 555.19 g/mol |
| Exact Mass | 553.93 |
| IUPAC Name | — |
| SMILES | O=C1c2cccc3c(Br)ccc(c23)C(=[O+])N1c1ccc([I-]c2ccccc2)cc1 |
| InChI | InChI=1S/C24H14BrINO2/c25-21-14-13-20-22-18(21)7-4-8-19(22)23(28)27(24(20)29)17-11-9-16(10-12-17)26-15-5-2-1-3-6-15/h1-14H |
| InChIKey | UPLNKPAOWHLCOU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 40.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|