C21H23BrN2O2 — CID 101197155
6-bromo-2-(2,2,6,6-tetramethylpiperidin-4-yl)benzo[de]isoquinoline-1,3-dione (PubChem CID 101197155) has the molecular formula C21H23BrN2O2 and a molecular weight of 415.33 g/mol. Its IUPAC name is 6-bromo-2-(2,2,6,6-tetramethylpiperidin-4-yl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-bromo-2-(2,2,6,6-tetramethylpiperidin-4-yl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 101197155 |
| Molecular Formula | C21H23BrN2O2 |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | 6-bromo-2-(2,2,6,6-tetramethylpiperidin-4-yl)benzo[de]isoquinoline-1,3-dione |
| SMILES | CC1(C)CC(N2C(=O)c3cccc4c(Br)ccc(c34)C2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C21H23BrN2O2/c1-20(2)10-12(11-21(3,4)23-20)24-18(25)14-7-5-6-13-16(22)9-8-15(17(13)14)19(24)26/h5-9,12,23H,10-11H2,1-4H3 |
| InChIKey | KVENGCCTHCBSTM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|