C17H17N3O2 — CID 19769415
6-amino-2-piperidin-4-ylbenzo[de]isoquinoline-1,3-dione (PubChem CID 19769415) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 6-amino-2-piperidin-4-ylbenzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-amino-2-piperidin-4-ylbenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 19769415 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 6-amino-2-piperidin-4-ylbenzo[de]isoquinoline-1,3-dione |
| SMILES | Nc1ccc2c3c(cccc13)C(=O)N(C1CCNCC1)C2=O |
| InChI | InChI=1S/C17H17N3O2/c18-14-5-4-13-15-11(14)2-1-3-12(15)16(21)20(17(13)22)10-6-8-19-9-7-10/h1-5,10,19H,6-9,18H2 |
| InChIKey | SUXFBGXOCJBUEI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|