C12H8N2O2 — CID 1720
6-aminobenzo[de]isoquinoline-1,3-dione (PubChem CID 1720) has the molecular formula C12H8N2O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 6-aminobenzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-aminobenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 1720 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 6-aminobenzo[de]isoquinoline-1,3-dione |
| SMILES | Nc1ccc2c3c(cccc13)C(=O)NC2=O |
| InChI | InChI=1S/C12H8N2O2/c13-9-5-4-8-10-6(9)2-1-3-7(10)11(15)14-12(8)16/h1-5H,13H2,(H,14,15,16) |
| InChIKey | SSMIFVHARFVINF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|