C22H27N3O2 — CID 102332297
6-(methylamino)-2-(2,2,6,6-tetramethylpiperidin-4-yl)benzo[de]isoquinoline-1,3-dione (PubChem CID 102332297) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 6-(methylamino)-2-(2,2,6,6-tetramethylpiperidin-4-yl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-(methylamino)-2-(2,2,6,6-tetramethylpiperidin-4-yl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 102332297 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 6-(methylamino)-2-(2,2,6,6-tetramethylpiperidin-4-yl)benzo[de]isoquinoline-1,3-dione |
| SMILES | CNc1ccc2c3c(cccc13)C(=O)N(C1CC(C)(C)NC(C)(C)C1)C2=O |
| InChI | InChI=1S/C22H27N3O2/c1-21(2)11-13(12-22(3,4)24-21)25-19(26)15-8-6-7-14-17(23-5)10-9-16(18(14)15)20(25)27/h6-10,13,23-24H,11-12H2,1-5H3 |
| InChIKey | NTHUQFOYDUWBIK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|