C20H28N4O3 — CID 19003324
N-(2-aminoethyl)-1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carboxamide (PubChem CID 19003324) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-(2-aminoethyl)-1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 19003324 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N-(2-aminoethyl)-1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carboxamide |
| SMILES | CC1(C)CC(N2C(=O)c3ccc(C(=O)NCCN)cc3C2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C20H28N4O3/c1-19(2)10-13(11-20(3,4)23-19)24-17(26)14-6-5-12(9-15(14)18(24)27)16(25)22-8-7-21/h5-6,9,13,23H,7-8,10-11,21H2,1-4H3,(H,22,25) |
| InChIKey | OHPVBJLMTTYHFZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|