C30H32N2O8 — CID 19003282
dimethyl 2-[[4-[1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carbonyl]oxyphenyl]methylidene]propanedioate (PubChem CID 19003282) has the molecular formula C30H32N2O8 and a molecular weight of 548.59 g/mol. Its IUPAC name is dimethyl 2-[[4-[1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carbonyl]oxyphenyl]methylidene]propanedioate.
| Compound Name | dimethyl 2-[[4-[1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carbonyl]oxyphenyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 19003282 |
| Molecular Formula | C30H32N2O8 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | dimethyl 2-[[4-[1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carbonyl]oxyphenyl]methylidene]propanedioate |
| SMILES | COC(=O)C(=Cc1ccc(OC(=O)c2ccc3c(c2)C(=O)N(C2CC(C)(C)NC(C)(C)C2)C3=O)cc1)C(=O)OC |
| InChI | InChI=1S/C30H32N2O8/c1-29(2)15-19(16-30(3,4)31-29)32-24(33)21-12-9-18(14-22(21)25(32)34)26(35)40-20-10-7-17(8-11-20)13-23(27(36)38-5)28(37)39-6/h7-14,19,31H,15-16H2,1-6H3 |
| InChIKey | YCIMCLOAUBWIQD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|