C42H54N4O11 — CID 54464966
[3-[3-[1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carbonyl]oxy-2-hydroxypropoxy]-2-hydroxypropyl] 1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carboxylate (PubChem CID 54464966) has the molecular formula C42H54N4O11 and a molecular weight of 790.91 g/mol. Its IUPAC name is [3-[3-[1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carbonyl]oxy-2-hydroxypropoxy]-2-hydroxypropyl] 1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carboxylate.
| Compound Name | [3-[3-[1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carbonyl]oxy-2-hydroxypropoxy]-2-hydroxypropyl] 1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carboxylate |
|---|---|
| PubChem CID | 54464966 |
| Molecular Formula | C42H54N4O11 |
| Molecular Weight | 790.91 g/mol |
| Exact Mass | 790.38 |
| IUPAC Name | [3-[3-[1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carbonyl]oxy-2-hydroxypropoxy]-2-hydroxypropyl] 1,3-dioxo-2-(2,2,6,6-tetramethylpiperidin-4-yl)isoindole-5-carboxylate |
| SMILES | CC1(C)CC(N2C(=O)c3ccc(C(=O)OCC(O)COCC(O)COC(=O)c4ccc5c(c4)C(=O)N(C4CC(C)(C)NC(C)(C)C4)C5=O)cc3C2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C42H54N4O11/c1-39(2)15-25(16-40(3,4)43-39)45-33(49)29-11-9-23(13-31(29)35(45)51)37(53)56-21-27(47)19-55-20-28(48)22-57-38(54)24-10-12-30-32(14-24)36(52)46(34(30)50)26-17-41(5,6)44-42(7,8)18-26/h9-14,25-28,43-44,47-48H,15-22H2,1-8H3 |
| InChIKey | XEEPUTMKNCCPFW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 201.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.91 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|