C20H19NO4 — CID 827675
2-methylpropyl 2-(4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 827675) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 2-methylpropyl 2-(4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | 2-methylpropyl 2-(4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 827675 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-methylpropyl 2-(4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(N2C(=O)c3ccc(C(=O)OCC(C)C)cc3C2=O)cc1 |
| InChI | InChI=1S/C20H19NO4/c1-12(2)11-25-20(24)14-6-9-16-17(10-14)19(23)21(18(16)22)15-7-4-13(3)5-8-15/h4-10,12H,11H2,1-3H3 |
| InChIKey | YEBRNTWZOGAAKY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|