C29H25NO7 — CID 5062804
[1-(4-methylphenyl)-1-oxopropan-2-yl] 1,3-dioxo-2-(4-propoxycarbonylphenyl)isoindole-5-carboxylate (PubChem CID 5062804) has the molecular formula C29H25NO7 and a molecular weight of 499.52 g/mol. Its IUPAC name is [1-(4-methylphenyl)-1-oxopropan-2-yl] 1,3-dioxo-2-(4-propoxycarbonylphenyl)isoindole-5-carboxylate.
| Compound Name | [1-(4-methylphenyl)-1-oxopropan-2-yl] 1,3-dioxo-2-(4-propoxycarbonylphenyl)isoindole-5-carboxylate |
|---|---|
| PubChem CID | 5062804 |
| Molecular Formula | C29H25NO7 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | [1-(4-methylphenyl)-1-oxopropan-2-yl] 1,3-dioxo-2-(4-propoxycarbonylphenyl)isoindole-5-carboxylate |
| SMILES | CCCOC(=O)c1ccc(N2C(=O)c3ccc(C(=O)OC(C)C(=O)c4ccc(C)cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C29H25NO7/c1-4-15-36-28(34)20-9-12-22(13-10-20)30-26(32)23-14-11-21(16-24(23)27(30)33)29(35)37-18(3)25(31)19-7-5-17(2)6-8-19/h5-14,16,18H,4,15H2,1-3H3 |
| InChIKey | RIDOLNIEZCXDOB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|